C27H31FN2S — CID 142015423
1-[[(3R)-1-benzyl-4-thiophen-3-ylpyrrolidin-3-yl]methyl]-4-(4-fluorophenyl)piperidine (PubChem CID 142015423) has the molecular formula C27H31FN2S and a molecular weight of 434.62 g/mol. Its IUPAC name is 1-[[(3R)-1-benzyl-4-thiophen-3-ylpyrrolidin-3-yl]methyl]-4-(4-fluorophenyl)piperidine.
| Compound Name | 1-[[(3R)-1-benzyl-4-thiophen-3-ylpyrrolidin-3-yl]methyl]-4-(4-fluorophenyl)piperidine |
|---|---|
| PubChem CID | 142015423 |
| Molecular Formula | C27H31FN2S |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 1-[[(3R)-1-benzyl-4-thiophen-3-ylpyrrolidin-3-yl]methyl]-4-(4-fluorophenyl)piperidine |
| SMILES | Fc1ccc(C2CCN(C[C@@H]3CN(Cc4ccccc4)CC3c3ccsc3)CC2)cc1 |
| InChI | InChI=1S/C27H31FN2S/c28-26-8-6-22(7-9-26)23-10-13-29(14-11-23)17-25-18-30(16-21-4-2-1-3-5-21)19-27(25)24-12-15-31-20-24/h1-9,12,15,20,23,25,27H,10-11,13-14,16-19H2/t25-,27?/m1/s1 |
| InChIKey | GUGHVQFJCKOQDU-CSMDKSQMSA-N |
| XLogP | 5.98 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |