About 4-cyclopentyl-N-(3,4-difluorophenyl)-2-hydroxybutanamide;N-hydroxyheptanamide
4-cyclopentyl-N-(3,4-difluorophenyl)-2-hydroxybutanamide;N-hydroxyheptanamide (PubChem CID 142015655) has the molecular formula C22H34F2N2O4
and a molecular weight of 428.52 g/mol. Its IUPAC name is 4-cyclopentyl-N-(3,4-difluorophenyl)-2-hydroxybutanamide;N-hydroxyheptanamide.
Molecular Properties
| Compound Name | 4-cyclopentyl-N-(3,4-difluorophenyl)-2-hydroxybutanamide;N-hydroxyheptanamide |
| PubChem CID | 142015655 |
| Molecular Formula | C22H34F2N2O4 |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | 4-cyclopentyl-N-(3,4-difluorophenyl)-2-hydroxybutanamide;N-hydroxyheptanamide |
| SMILES | CCCCCCC(=O)NO.O=C(Nc1ccc(F)c(F)c1)C(O)CCC1CCCC1 |
| InChI | InChI=1S/C15H19F2NO2.C7H15NO2/c16-12-7-6-11(9-13(12)17)18-15(20)14(19)8-5-10-3-1-2-4-10;1-2-3-4-5-6-7(9)8-10/h6-7,9-10,14,19H,1-5,8H2,(H,18,20);10H,2-6H2,1H3,(H,8,9) |
| InChIKey | RZUPFTRXFWCBJG-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclopentyl-N-(3,4-difluorophenyl)-2-hydroxybutanamide;N-hydroxyheptanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopentyl-N-(3,4-difluorophenyl)-2-hydroxybutanamide;N-hydroxyheptanamide?
The IUPAC name of 4-cyclopentyl-N-(3,4-difluorophenyl)-2-hydroxybutanamide;N-hydroxyheptanamide (CID 142015655) is 4-cyclopentyl-N-(3,4-difluorophenyl)-2-hydroxybutanamide;N-hydroxyheptanamide.
What is the SMILES notation for 4-cyclopentyl-N-(3,4-difluorophenyl)-2-hydroxybutanamide;N-hydroxyheptanamide?
The canonical SMILES for 4-cyclopentyl-N-(3,4-difluorophenyl)-2-hydroxybutanamide;N-hydroxyheptanamide is CCCCCCC(=O)NO.O=C(Nc1ccc(F)c(F)c1)C(O)CCC1CCCC1.
What is the InChIKey of 4-cyclopentyl-N-(3,4-difluorophenyl)-2-hydroxybutanamide;N-hydroxyheptanamide?
The InChIKey is RZUPFTRXFWCBJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19F2NO2.C7H15NO2/c16-12-7-6-11(9-13(12)17)18-15(20)14(19)8-5-10-3-1-2-4-10;1-2-3-4-5-6-7(9)8-10/h6-7,9-10,14,19H,1-5,8H2,(H,18,20);10H,2-6H2,1H3,(H,8,9).
What are the key properties of 4-cyclopentyl-N-(3,4-difluorophenyl)-2-hydroxybutanamide;N-hydroxyheptanamide?
4-cyclopentyl-N-(3,4-difluorophenyl)-2-hydroxybutanamide;N-hydroxyheptanamide has a molecular weight of 428.52 g/mol, XLogP of 4.70, 10 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopentyl-N-(3,4-difluorophenyl)-2-hydroxybutanamide;N-hydroxyheptanamide is sourced from PubChem (CID 142015655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).