C9H18N4S2 — CID 142015939
N',N'-dimethyl-N-[4-methyl-5-(methylaminosulfanyl)-1,3-thiazol-2-yl]ethane-1,2-diamine (PubChem CID 142015939) has the molecular formula C9H18N4S2 and a molecular weight of 246.40 g/mol. Its IUPAC name is N',N'-dimethyl-N-[4-methyl-5-(methylaminosulfanyl)-1,3-thiazol-2-yl]ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-[4-methyl-5-(methylaminosulfanyl)-1,3-thiazol-2-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 142015939 |
| Molecular Formula | C9H18N4S2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | N',N'-dimethyl-N-[4-methyl-5-(methylaminosulfanyl)-1,3-thiazol-2-yl]ethane-1,2-diamine |
| SMILES | CNSc1sc(NCCN(C)C)nc1C |
| InChI | InChI=1S/C9H18N4S2/c1-7-8(15-10-2)14-9(12-7)11-5-6-13(3)4/h10H,5-6H2,1-4H3,(H,11,12) |
| InChIKey | KYEABIWCCLSQQL-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|