C16H26O2 — CID 142016297
2,2-dimethyl-5-[(E)-6-methylnon-2-en-2-yl]furan-3-one (PubChem CID 142016297) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is 2,2-dimethyl-5-[(E)-6-methylnon-2-en-2-yl]furan-3-one.
| Compound Name | 2,2-dimethyl-5-[(E)-6-methylnon-2-en-2-yl]furan-3-one |
|---|---|
| PubChem CID | 142016297 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 2,2-dimethyl-5-[(E)-6-methylnon-2-en-2-yl]furan-3-one |
| SMILES | CCCC(C)CC/C=C(\C)C1=CC(=O)C(C)(C)O1 |
| InChI | InChI=1S/C16H26O2/c1-6-8-12(2)9-7-10-13(3)14-11-15(17)16(4,5)18-14/h10-12H,6-9H2,1-5H3/b13-10+ |
| InChIKey | CZWQIBJXYQUIDA-JLHYYAGUSA-N |
| XLogP | 4.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |