C27H19N3O3 — CID 142016313
(15S,16S)-15-ethynyl-16-hydroxy-16-methyl-28-oxa-4,14,19-triazaoctacyclo[12.11.2.115,18.02,6.07,27.08,13.019,26.020,25]octacosa-1,6,8,10,12,20,22,24,26-nonaen-3-one (PubChem CID 142016313) has the molecular formula C27H19N3O3 and a molecular weight of 433.47 g/mol. Its IUPAC name is (15S,16S)-15-ethynyl-16-hydroxy-16-methyl-28-oxa-4,14,19-triazaoctacyclo[12.11.2.115,18.02,6.07,27.08,13.019,26.020,25]octacosa-1,6,8,10,12,20,22,24,26-nonaen-3-one.
| Compound Name | (15S,16S)-15-ethynyl-16-hydroxy-16-methyl-28-oxa-4,14,19-triazaoctacyclo[12.11.2.115,18.02,6.07,27.08,13.019,26.020,25]octacosa-1,6,8,10,12,20,22,24,26-nonaen-3-one |
|---|---|
| PubChem CID | 142016313 |
| Molecular Formula | C27H19N3O3 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | (15S,16S)-15-ethynyl-16-hydroxy-16-methyl-28-oxa-4,14,19-triazaoctacyclo[12.11.2.115,18.02,6.07,27.08,13.019,26.020,25]octacosa-1,6,8,10,12,20,22,24,26-nonaen-3-one |
| SMILES | C#C[C@]12OC(C[C@]1(C)O)n1c3ccccc3c3c4c(c5c6ccccc6n2c5c31)CNC4=O |
| InChI | InChI=1S/C27H19N3O3/c1-3-27-26(2,32)12-19(33-27)29-17-10-6-4-8-14(17)21-22-16(13-28-25(22)31)20-15-9-5-7-11-18(15)30(27)24(20)23(21)29/h1,4-11,19,32H,12-13H2,2H3,(H,28,31)/t19?,26-,27-/m0/s1 |
| InChIKey | FXVNAOSLUPGYEZ-OGLOGDKOSA-N |
| XLogP | 4.12 |
| TPSA | 68.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|