C18H32O — CID 142016467
ethane;propane;1,1,3,3-tetramethyl-2H-inden-5-ol (PubChem CID 142016467) has the molecular formula C18H32O and a molecular weight of 264.45 g/mol. Its IUPAC name is ethane;propane;1,1,3,3-tetramethyl-2H-inden-5-ol.
| Compound Name | ethane;propane;1,1,3,3-tetramethyl-2H-inden-5-ol |
|---|---|
| PubChem CID | 142016467 |
| Molecular Formula | C18H32O |
| Molecular Weight | 264.45 g/mol |
| Exact Mass | 264.25 |
| IUPAC Name | ethane;propane;1,1,3,3-tetramethyl-2H-inden-5-ol |
| SMILES | CC.CC1(C)CC(C)(C)c2cc(O)ccc21.CCC |
| InChI | InChI=1S/C13H18O.C3H8.C2H6/c1-12(2)8-13(3,4)11-7-9(14)5-6-10(11)12;1-3-2;1-2/h5-7,14H,8H2,1-4H3;3H2,1-2H3;1-2H3 |
| InChIKey | MVNMUSPHYXJUCI-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.45 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |