C25H35FN6O2 — CID 142016850
2-[2-[(2S)-1-[2-[(3S,6S)-3-amino-6-(fluoromethyl)-2-oxopiperidin-1-yl]acetyl]pyrrolidin-2-yl]ethyl]-1-ethylindole-6-carboximidamide (PubChem CID 142016850) has the molecular formula C25H35FN6O2 and a molecular weight of 470.59 g/mol. Its IUPAC name is 2-[2-[(2S)-1-[2-[(3S,6S)-3-amino-6-(fluoromethyl)-2-oxopiperidin-1-yl]acetyl]pyrrolidin-2-yl]ethyl]-1-ethylindole-6-carboximidamide.
| Compound Name | 2-[2-[(2S)-1-[2-[(3S,6S)-3-amino-6-(fluoromethyl)-2-oxopiperidin-1-yl]acetyl]pyrrolidin-2-yl]ethyl]-1-ethylindole-6-carboximidamide |
|---|---|
| PubChem CID | 142016850 |
| Molecular Formula | C25H35FN6O2 |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.28 |
| IUPAC Name | 2-[2-[(2S)-1-[2-[(3S,6S)-3-amino-6-(fluoromethyl)-2-oxopiperidin-1-yl]acetyl]pyrrolidin-2-yl]ethyl]-1-ethylindole-6-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2cc(CC[C@@H]3CCCN3C(=O)CN3C(=O)[C@@H](N)CC[C@H]3CF)n(CC)c2c1 |
| InChI | InChI=1S/C25H35FN6O2/c1-2-30-19(12-16-5-6-17(24(28)29)13-22(16)30)8-7-18-4-3-11-31(18)23(33)15-32-20(14-26)9-10-21(27)25(32)34/h5-6,12-13,18,20-21H,2-4,7-11,14-15,27H2,1H3,(H3,28,29)/t18-,20-,21-/m0/s1 |
| InChIKey | VNUCOBKIAYIVAK-JBACZVJFSA-N |
| XLogP | 2.16 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|