C18H17F6NO2 — CID 142017240
N-cyclohexa-1,5-dien-1-yl-N-ethyl-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)benzamide (PubChem CID 142017240) has the molecular formula C18H17F6NO2 and a molecular weight of 393.33 g/mol. Its IUPAC name is N-cyclohexa-1,5-dien-1-yl-N-ethyl-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)benzamide.
| Compound Name | N-cyclohexa-1,5-dien-1-yl-N-ethyl-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)benzamide |
|---|---|
| PubChem CID | 142017240 |
| Molecular Formula | C18H17F6NO2 |
| Molecular Weight | 393.33 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | N-cyclohexa-1,5-dien-1-yl-N-ethyl-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)benzamide |
| SMILES | CCN(C(=O)c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1)C1=CCCC=C1 |
| InChI | InChI=1S/C18H17F6NO2/c1-2-25(14-6-4-3-5-7-14)15(26)12-8-10-13(11-9-12)16(27,17(19,20)21)18(22,23)24/h4,6-11,27H,2-3,5H2,1H3 |
| InChIKey | SPSUMADIIFSIHU-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.33 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |