C30H37FN8 — CID 142017414
N'-[4-[[6-[[4-(4-fluorophenyl)phenyl]methylamino]-9-propan-2-ylpurin-2-yl]amino]cyclohexyl]propanimidamide (PubChem CID 142017414) has the molecular formula C30H37FN8 and a molecular weight of 528.68 g/mol. Its IUPAC name is N'-[4-[[6-[[4-(4-fluorophenyl)phenyl]methylamino]-9-propan-2-ylpurin-2-yl]amino]cyclohexyl]propanimidamide.
| Compound Name | N'-[4-[[6-[[4-(4-fluorophenyl)phenyl]methylamino]-9-propan-2-ylpurin-2-yl]amino]cyclohexyl]propanimidamide |
|---|---|
| PubChem CID | 142017414 |
| Molecular Formula | C30H37FN8 |
| Molecular Weight | 528.68 g/mol |
| Exact Mass | 528.31 |
| IUPAC Name | N'-[4-[[6-[[4-(4-fluorophenyl)phenyl]methylamino]-9-propan-2-ylpurin-2-yl]amino]cyclohexyl]propanimidamide |
| SMILES | CC/C(N)=N\C1CCC(Nc2nc(NCc3ccc(-c4ccc(F)cc4)cc3)c3ncn(C(C)C)c3n2)CC1 |
| InChI | InChI=1S/C30H37FN8/c1-4-26(32)35-24-13-15-25(16-14-24)36-30-37-28(27-29(38-30)39(18-34-27)19(2)3)33-17-20-5-7-21(8-6-20)22-9-11-23(31)12-10-22/h5-12,18-19,24-25H,4,13-17H2,1-3H3,(H2,32,35)(H2,33,36,37,38) |
| InChIKey | REWYAWMQFBPQOR-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 106.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.68 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|