C29H46FN — CID 142017509
(2Z,7E,9E)-3-[4-(5-butylcyclohepta-1,6-dien-1-yl)-3-methylbut-1-en-2-yl]-10-fluoro-6,7-dimethylundeca-2,7,9-trien-1-amine (PubChem CID 142017509) has the molecular formula C29H46FN and a molecular weight of 427.69 g/mol. Its IUPAC name is (2Z,7E,9E)-3-[4-(5-butylcyclohepta-1,6-dien-1-yl)-3-methylbut-1-en-2-yl]-10-fluoro-6,7-dimethylundeca-2,7,9-trien-1-amine.
| Compound Name | (2Z,7E,9E)-3-[4-(5-butylcyclohepta-1,6-dien-1-yl)-3-methylbut-1-en-2-yl]-10-fluoro-6,7-dimethylundeca-2,7,9-trien-1-amine |
|---|---|
| PubChem CID | 142017509 |
| Molecular Formula | C29H46FN |
| Molecular Weight | 427.69 g/mol |
| Exact Mass | 427.36 |
| IUPAC Name | (2Z,7E,9E)-3-[4-(5-butylcyclohepta-1,6-dien-1-yl)-3-methylbut-1-en-2-yl]-10-fluoro-6,7-dimethylundeca-2,7,9-trien-1-amine |
| SMILES | C=C(/C(=C\CN)CCC(C)/C(C)=C/C=C(\C)F)C(C)CC1=CCCC(CCCC)C=C1 |
| InChI | InChI=1S/C29H46FN/c1-7-8-10-27-11-9-12-28(17-16-27)21-24(4)26(6)29(19-20-31)18-14-23(3)22(2)13-15-25(5)30/h12-13,15-17,19,23-24,27H,6-11,14,18,20-21,31H2,1-5H3/b22-13+,25-15+,29-19- |
| InChIKey | YTRXUEVDMCQDIH-PWXHNAJESA-N |
| XLogP | 8.77 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.69 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|