C13H18N2O8 — CID 14201780
tetramethyl (3R,4S,5R)-2-methyl-4,5-dihydro-3H-pyridazine-3,4,5,6-tetracarboxylate (PubChem CID 14201780) has the molecular formula C13H18N2O8 and a molecular weight of 330.29 g/mol. Its IUPAC name is tetramethyl (3R,4S,5R)-2-methyl-4,5-dihydro-3H-pyridazine-3,4,5,6-tetracarboxylate.
| Compound Name | tetramethyl (3R,4S,5R)-2-methyl-4,5-dihydro-3H-pyridazine-3,4,5,6-tetracarboxylate |
|---|---|
| PubChem CID | 14201780 |
| Molecular Formula | C13H18N2O8 |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | tetramethyl (3R,4S,5R)-2-methyl-4,5-dihydro-3H-pyridazine-3,4,5,6-tetracarboxylate |
| SMILES | COC(=O)C1=NN(C)[C@@H](C(=O)OC)[C@@H](C(=O)OC)[C@H]1C(=O)OC |
| InChI | InChI=1S/C13H18N2O8/c1-15-9(13(19)23-5)7(11(17)21-3)6(10(16)20-2)8(14-15)12(18)22-4/h6-7,9H,1-5H3/t6-,7+,9-/m1/s1 |
| InChIKey | NAEKAULGCNMVOQ-BKPPORCPSA-N |
| XLogP | -1.42 |
| TPSA | 120.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|