C15H22N2O8 — CID 14201792
5-O,6-O-diethyl 3-O,4-O-dimethyl (3R,4R,5R)-2-methyl-4,5-dihydro-3H-pyridazine-3,4,5,6-tetracarboxylate (PubChem CID 14201792) has the molecular formula C15H22N2O8 and a molecular weight of 358.35 g/mol. Its IUPAC name is 5-O,6-O-diethyl 3-O,4-O-dimethyl (3R,4R,5R)-2-methyl-4,5-dihydro-3H-pyridazine-3,4,5,6-tetracarboxylate.
| Compound Name | 5-O,6-O-diethyl 3-O,4-O-dimethyl (3R,4R,5R)-2-methyl-4,5-dihydro-3H-pyridazine-3,4,5,6-tetracarboxylate |
|---|---|
| PubChem CID | 14201792 |
| Molecular Formula | C15H22N2O8 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 5-O,6-O-diethyl 3-O,4-O-dimethyl (3R,4R,5R)-2-methyl-4,5-dihydro-3H-pyridazine-3,4,5,6-tetracarboxylate |
| SMILES | CCOC(=O)C1=NN(C)[C@@H](C(=O)OC)[C@H](C(=O)OC)[C@H]1C(=O)OCC |
| InChI | InChI=1S/C15H22N2O8/c1-6-24-13(19)8-9(12(18)22-4)11(15(21)23-5)17(3)16-10(8)14(20)25-7-2/h8-9,11H,6-7H2,1-5H3/t8-,9-,11-/m1/s1 |
| InChIKey | HXZWTOUHNKZLIL-FXPVBKGRSA-N |
| XLogP | -0.64 |
| TPSA | 120.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|