C17H26N2O8 — CID 14201794
tetraethyl (3R,4R,5R)-2-methyl-4,5-dihydro-3H-pyridazine-3,4,5,6-tetracarboxylate (PubChem CID 14201794) has the molecular formula C17H26N2O8 and a molecular weight of 386.40 g/mol. Its IUPAC name is tetraethyl (3R,4R,5R)-2-methyl-4,5-dihydro-3H-pyridazine-3,4,5,6-tetracarboxylate.
| Compound Name | tetraethyl (3R,4R,5R)-2-methyl-4,5-dihydro-3H-pyridazine-3,4,5,6-tetracarboxylate |
|---|---|
| PubChem CID | 14201794 |
| Molecular Formula | C17H26N2O8 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | tetraethyl (3R,4R,5R)-2-methyl-4,5-dihydro-3H-pyridazine-3,4,5,6-tetracarboxylate |
| SMILES | CCOC(=O)C1=NN(C)[C@@H](C(=O)OCC)[C@H](C(=O)OCC)[C@H]1C(=O)OCC |
| InChI | InChI=1S/C17H26N2O8/c1-6-24-14(20)10-11(15(21)25-7-2)13(17(23)27-9-4)19(5)18-12(10)16(22)26-8-3/h10-11,13H,6-9H2,1-5H3/t10-,11-,13-/m1/s1 |
| InChIKey | YSESDOJJKANBLM-NQBHXWOUSA-N |
| XLogP | 0.14 |
| TPSA | 120.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|