About bicyclo[6.1.0]non-4-yne
bicyclo[6.1.0]non-4-yne (PubChem CID 14201804) has the molecular formula C9H12
and a molecular weight of 120.19 g/mol. Its IUPAC name is bicyclo[6.1.0]non-4-yne.
Molecular Properties
| Compound Name | bicyclo[6.1.0]non-4-yne |
| PubChem CID | 14201804 |
| Molecular Formula | C9H12 |
| Molecular Weight | 120.19 g/mol |
| Exact Mass | 120.09 |
| IUPAC Name | bicyclo[6.1.0]non-4-yne |
| SMILES | C1#CCCC2CC2CC1 |
| InChI | InChI=1S/C9H12/c1-2-4-6-9-7-8(9)5-3-1/h8-9H,3-7H2 |
| InChIKey | QDNSAFCVPAMWCJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.19 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[6.1.0]non-4-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[6.1.0]non-4-yne?
The IUPAC name of bicyclo[6.1.0]non-4-yne (CID 14201804) is bicyclo[6.1.0]non-4-yne.
What is the SMILES notation for bicyclo[6.1.0]non-4-yne?
The canonical SMILES for bicyclo[6.1.0]non-4-yne is C1#CCCC2CC2CC1.
What is the InChIKey of bicyclo[6.1.0]non-4-yne?
The InChIKey is QDNSAFCVPAMWCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12/c1-2-4-6-9-7-8(9)5-3-1/h8-9H,3-7H2.
What are the key properties of bicyclo[6.1.0]non-4-yne?
bicyclo[6.1.0]non-4-yne has a molecular weight of 120.19 g/mol, XLogP of 2.20, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[6.1.0]non-4-yne is sourced from PubChem (CID 14201804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).