About 4-(2,3-dihydro-1,3-oxazol-5-yl)-3-methoxy-N-methylaniline
4-(2,3-dihydro-1,3-oxazol-5-yl)-3-methoxy-N-methylaniline (PubChem CID 142018117) has the molecular formula C11H14N2O2
and a molecular weight of 206.24 g/mol. Its IUPAC name is 4-(2,3-dihydro-1,3-oxazol-5-yl)-3-methoxy-N-methylaniline.
Molecular Properties
| Compound Name | 4-(2,3-dihydro-1,3-oxazol-5-yl)-3-methoxy-N-methylaniline |
| PubChem CID | 142018117 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 4-(2,3-dihydro-1,3-oxazol-5-yl)-3-methoxy-N-methylaniline |
| SMILES | CNc1ccc(C2=CNCO2)c(OC)c1 |
| InChI | InChI=1S/C11H14N2O2/c1-12-8-3-4-9(10(5-8)14-2)11-6-13-7-15-11/h3-6,12-13H,7H2,1-2H3 |
| InChIKey | ANYBNFQTOYXGHA-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2,3-dihydro-1,3-oxazol-5-yl)-3-methoxy-N-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,3-dihydro-1,3-oxazol-5-yl)-3-methoxy-N-methylaniline?
The IUPAC name of 4-(2,3-dihydro-1,3-oxazol-5-yl)-3-methoxy-N-methylaniline (CID 142018117) is 4-(2,3-dihydro-1,3-oxazol-5-yl)-3-methoxy-N-methylaniline.
What is the SMILES notation for 4-(2,3-dihydro-1,3-oxazol-5-yl)-3-methoxy-N-methylaniline?
The canonical SMILES for 4-(2,3-dihydro-1,3-oxazol-5-yl)-3-methoxy-N-methylaniline is CNc1ccc(C2=CNCO2)c(OC)c1.
What is the InChIKey of 4-(2,3-dihydro-1,3-oxazol-5-yl)-3-methoxy-N-methylaniline?
The InChIKey is ANYBNFQTOYXGHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O2/c1-12-8-3-4-9(10(5-8)14-2)11-6-13-7-15-11/h3-6,12-13H,7H2,1-2H3.
What are the key properties of 4-(2,3-dihydro-1,3-oxazol-5-yl)-3-methoxy-N-methylaniline?
4-(2,3-dihydro-1,3-oxazol-5-yl)-3-methoxy-N-methylaniline has a molecular weight of 206.24 g/mol, XLogP of 1.61, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-dihydro-1,3-oxazol-5-yl)-3-methoxy-N-methylaniline is sourced from PubChem (CID 142018117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).