C15H21NS — CID 142018361
ethane;3-[(2E,4Z)-hexa-2,4-dien-2-yl]-5-methyl-5H-cyclopenta[d][1,2]thiazole (PubChem CID 142018361) has the molecular formula C15H21NS and a molecular weight of 247.41 g/mol. Its IUPAC name is ethane;3-[(2E,4Z)-hexa-2,4-dien-2-yl]-5-methyl-5H-cyclopenta[d][1,2]thiazole.
| Compound Name | ethane;3-[(2E,4Z)-hexa-2,4-dien-2-yl]-5-methyl-5H-cyclopenta[d][1,2]thiazole |
|---|---|
| PubChem CID | 142018361 |
| Molecular Formula | C15H21NS |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | ethane;3-[(2E,4Z)-hexa-2,4-dien-2-yl]-5-methyl-5H-cyclopenta[d][1,2]thiazole |
| SMILES | C/C=C\C=C(/C)c1nsc2c1=CC(C)C=2.CC |
| InChI | InChI=1S/C13H15NS.C2H6/c1-4-5-6-10(3)13-11-7-9(2)8-12(11)15-14-13;1-2/h4-9H,1-3H3;1-2H3/b5-4-,10-6+; |
| InChIKey | AQELKMHLSYCIJG-CTCRGEBPSA-N |
| XLogP | 3.36 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|