C15H21N3O3 — CID 142019495
4-amino-N-[[(1R,2R)-2-(hydroxycarbamoyl)cyclohexyl]methyl]benzamide (PubChem CID 142019495) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 4-amino-N-[[(1R,2R)-2-(hydroxycarbamoyl)cyclohexyl]methyl]benzamide.
| Compound Name | 4-amino-N-[[(1R,2R)-2-(hydroxycarbamoyl)cyclohexyl]methyl]benzamide |
|---|---|
| PubChem CID | 142019495 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 4-amino-N-[[(1R,2R)-2-(hydroxycarbamoyl)cyclohexyl]methyl]benzamide |
| SMILES | Nc1ccc(C(=O)NC[C@@H]2CCCC[C@H]2C(=O)NO)cc1 |
| InChI | InChI=1S/C15H21N3O3/c16-12-7-5-10(6-8-12)14(19)17-9-11-3-1-2-4-13(11)15(20)18-21/h5-8,11,13,21H,1-4,9,16H2,(H,17,19)(H,18,20)/t11-,13+/m0/s1 |
| InChIKey | ULSSCACCAXTMHT-WCQYABFASA-N |
| XLogP | 1.31 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|