C9H15NO — CID 142019666
4,5-bis(ethenyl)-2,3-dihydro-1,3-oxazole;ethane (PubChem CID 142019666) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is 4,5-bis(ethenyl)-2,3-dihydro-1,3-oxazole;ethane.
| Compound Name | 4,5-bis(ethenyl)-2,3-dihydro-1,3-oxazole;ethane |
|---|---|
| PubChem CID | 142019666 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 4,5-bis(ethenyl)-2,3-dihydro-1,3-oxazole;ethane |
| SMILES | C=CC1=C(C=C)OCN1.CC |
| InChI | InChI=1S/C7H9NO.C2H6/c1-3-6-7(4-2)9-5-8-6;1-2/h3-4,8H,1-2,5H2;1-2H3 |
| InChIKey | NJBIBLCNAVAXTP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |