C16H28O5S — CID 142019814
(1S,3aS,7aR)-3a-hydroxy-7a-methyl-1-[(1R)-1-(3-methylsulfonylpropoxy)ethyl]-1,2,3,5,6,7-hexahydroinden-4-one (PubChem CID 142019814) has the molecular formula C16H28O5S and a molecular weight of 332.46 g/mol. Its IUPAC name is (1S,3aS,7aR)-3a-hydroxy-7a-methyl-1-[(1R)-1-(3-methylsulfonylpropoxy)ethyl]-1,2,3,5,6,7-hexahydroinden-4-one.
| Compound Name | (1S,3aS,7aR)-3a-hydroxy-7a-methyl-1-[(1R)-1-(3-methylsulfonylpropoxy)ethyl]-1,2,3,5,6,7-hexahydroinden-4-one |
|---|---|
| PubChem CID | 142019814 |
| Molecular Formula | C16H28O5S |
| Molecular Weight | 332.46 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | (1S,3aS,7aR)-3a-hydroxy-7a-methyl-1-[(1R)-1-(3-methylsulfonylpropoxy)ethyl]-1,2,3,5,6,7-hexahydroinden-4-one |
| SMILES | C[C@@H](OCCCS(C)(=O)=O)[C@H]1CC[C@@]2(O)C(=O)CCC[C@]12C |
| InChI | InChI=1S/C16H28O5S/c1-12(21-10-5-11-22(3,19)20)13-7-9-16(18)14(17)6-4-8-15(13,16)2/h12-13,18H,4-11H2,1-3H3/t12-,13-,15-,16-/m1/s1 |
| InChIKey | PNWFARGHJBCPJG-RRCSTGOVSA-N |
| XLogP | 1.73 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.46 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|