About 1-(5-fluoro-6-methylcyclohexa-1,5-dien-1-yl)ethanol
1-(5-fluoro-6-methylcyclohexa-1,5-dien-1-yl)ethanol (PubChem CID 142019954) has the molecular formula C9H13FO
and a molecular weight of 156.20 g/mol. Its IUPAC name is 1-(5-fluoro-6-methylcyclohexa-1,5-dien-1-yl)ethanol.
Molecular Properties
| Compound Name | 1-(5-fluoro-6-methylcyclohexa-1,5-dien-1-yl)ethanol |
| PubChem CID | 142019954 |
| Molecular Formula | C9H13FO |
| Molecular Weight | 156.20 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | 1-(5-fluoro-6-methylcyclohexa-1,5-dien-1-yl)ethanol |
| SMILES | CC1=C(F)CCC=C1C(C)O |
| InChI | InChI=1S/C9H13FO/c1-6-8(7(2)11)4-3-5-9(6)10/h4,7,11H,3,5H2,1-2H3 |
| InChIKey | KQTLZMXTEXKHFN-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.20 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(5-fluoro-6-methylcyclohexa-1,5-dien-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-fluoro-6-methylcyclohexa-1,5-dien-1-yl)ethanol?
The IUPAC name of 1-(5-fluoro-6-methylcyclohexa-1,5-dien-1-yl)ethanol (CID 142019954) is 1-(5-fluoro-6-methylcyclohexa-1,5-dien-1-yl)ethanol.
What is the SMILES notation for 1-(5-fluoro-6-methylcyclohexa-1,5-dien-1-yl)ethanol?
The canonical SMILES for 1-(5-fluoro-6-methylcyclohexa-1,5-dien-1-yl)ethanol is CC1=C(F)CCC=C1C(C)O.
What is the InChIKey of 1-(5-fluoro-6-methylcyclohexa-1,5-dien-1-yl)ethanol?
The InChIKey is KQTLZMXTEXKHFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13FO/c1-6-8(7(2)11)4-3-5-9(6)10/h4,7,11H,3,5H2,1-2H3.
What are the key properties of 1-(5-fluoro-6-methylcyclohexa-1,5-dien-1-yl)ethanol?
1-(5-fluoro-6-methylcyclohexa-1,5-dien-1-yl)ethanol has a molecular weight of 156.20 g/mol, XLogP of 2.33, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-fluoro-6-methylcyclohexa-1,5-dien-1-yl)ethanol is sourced from PubChem (CID 142019954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).