About cis-(1S,4R)-1-iodo-3,4-dimethyl-2-(5-methylhexan-2-yl)cyclohexane
cis-(1S,4R)-1-iodo-3,4-dimethyl-2-(5-methylhexan-2-yl)cyclohexane (PubChem CID 142020146) has the molecular formula C15H29I
and a molecular weight of 336.30 g/mol. Its IUPAC name is cis-(1S,4R)-1-iodo-3,4-dimethyl-2-(5-methylhexan-2-yl)cyclohexane.
Molecular Properties
| Compound Name | cis-(1S,4R)-1-iodo-3,4-dimethyl-2-(5-methylhexan-2-yl)cyclohexane |
| PubChem CID | 142020146 |
| Molecular Formula | C15H29I |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | cis-(1S,4R)-1-iodo-3,4-dimethyl-2-(5-methylhexan-2-yl)cyclohexane |
| SMILES | CC(C)CCC(C)C1C(C)[C@H](C)CC[C@@H]1I |
| InChI | InChI=1S/C15H29I/c1-10(2)6-7-12(4)15-13(5)11(3)8-9-14(15)16/h10-15H,6-9H2,1-5H3/t11-,12?,13?,14+,15?/m1/s1 |
| InChIKey | GZCGUYNSUGLMOB-HADJJHBGSA-N |
| XLogP | 5.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze cis-(1S,4R)-1-iodo-3,4-dimethyl-2-(5-methylhexan-2-yl)cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,4R)-1-iodo-3,4-dimethyl-2-(5-methylhexan-2-yl)cyclohexane?
The IUPAC name of cis-(1S,4R)-1-iodo-3,4-dimethyl-2-(5-methylhexan-2-yl)cyclohexane (CID 142020146) is cis-(1S,4R)-1-iodo-3,4-dimethyl-2-(5-methylhexan-2-yl)cyclohexane.
What is the SMILES notation for cis-(1S,4R)-1-iodo-3,4-dimethyl-2-(5-methylhexan-2-yl)cyclohexane?
The canonical SMILES for cis-(1S,4R)-1-iodo-3,4-dimethyl-2-(5-methylhexan-2-yl)cyclohexane is CC(C)CCC(C)C1C(C)[C@H](C)CC[C@@H]1I.
What is the InChIKey of cis-(1S,4R)-1-iodo-3,4-dimethyl-2-(5-methylhexan-2-yl)cyclohexane?
The InChIKey is GZCGUYNSUGLMOB-HADJJHBGSA-N. The full InChI is InChI=1S/C15H29I/c1-10(2)6-7-12(4)15-13(5)11(3)8-9-14(15)16/h10-15H,6-9H2,1-5H3/t11-,12?,13?,14+,15?/m1/s1.
What are the key properties of cis-(1S,4R)-1-iodo-3,4-dimethyl-2-(5-methylhexan-2-yl)cyclohexane?
cis-(1S,4R)-1-iodo-3,4-dimethyl-2-(5-methylhexan-2-yl)cyclohexane has a molecular weight of 336.30 g/mol, XLogP of 5.54, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,4R)-1-iodo-3,4-dimethyl-2-(5-methylhexan-2-yl)cyclohexane is sourced from PubChem (CID 142020146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).