C10H12N2 — CID 142020152
6-ethenyl-2-ethyl-1,3-diazaspiro[3.4]octa-2,5,7-triene (PubChem CID 142020152) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 6-ethenyl-2-ethyl-1,3-diazaspiro[3.4]octa-2,5,7-triene.
| Compound Name | 6-ethenyl-2-ethyl-1,3-diazaspiro[3.4]octa-2,5,7-triene |
|---|---|
| PubChem CID | 142020152 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 6-ethenyl-2-ethyl-1,3-diazaspiro[3.4]octa-2,5,7-triene |
| SMILES | C=CC1=CC2(C=C1)N=C(CC)N2 |
| InChI | InChI=1S/C10H12N2/c1-3-8-5-6-10(7-8)11-9(4-2)12-10/h3,5-7H,1,4H2,2H3,(H,11,12) |
| InChIKey | YVWFQCOFXDPEOC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |