C35H49F3N2O — CID 142021072
(E)-1-cyclobutyl-2-(3-phenylpyrrolidin-1-yl)hex-3-en-3-ol;4-[3,3-difluoro-3-(4-fluorophenyl)propyl]-1-methylpiperidine (PubChem CID 142021072) has the molecular formula C35H49F3N2O and a molecular weight of 570.78 g/mol. Its IUPAC name is (E)-1-cyclobutyl-2-(3-phenylpyrrolidin-1-yl)hex-3-en-3-ol;4-[3,3-difluoro-3-(4-fluorophenyl)propyl]-1-methylpiperidine.
| Compound Name | (E)-1-cyclobutyl-2-(3-phenylpyrrolidin-1-yl)hex-3-en-3-ol;4-[3,3-difluoro-3-(4-fluorophenyl)propyl]-1-methylpiperidine |
|---|---|
| PubChem CID | 142021072 |
| Molecular Formula | C35H49F3N2O |
| Molecular Weight | 570.78 g/mol |
| Exact Mass | 570.38 |
| IUPAC Name | (E)-1-cyclobutyl-2-(3-phenylpyrrolidin-1-yl)hex-3-en-3-ol;4-[3,3-difluoro-3-(4-fluorophenyl)propyl]-1-methylpiperidine |
| SMILES | CC/C=C(/O)C(CC1CCC1)N1CCC(c2ccccc2)C1.CN1CCC(CCC(F)(F)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H29NO.C15H20F3N/c1-2-7-20(22)19(14-16-8-6-9-16)21-13-12-18(15-21)17-10-4-3-5-11-17;1-19-10-7-12(8-11-19)6-9-15(17,18)13-2-4-14(16)5-3-13/h3-5,7,10-11,16,18-19,22H,2,6,8-9,12-15H2,1H3;2-5,12H,6-11H2,1H3/b20-7+; |
| InChIKey | BHEQHQQGSUONFI-YYJLQXKGSA-N |
| XLogP | 8.93 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.78 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|