About 4-[[3-(1,1-difluoroethyl)-1H-pyrazol-5-yl]methyl]-1-methylpiperidine;hexane
4-[[3-(1,1-difluoroethyl)-1H-pyrazol-5-yl]methyl]-1-methylpiperidine;hexane (PubChem CID 142021337) has the molecular formula C18H33F2N3
and a molecular weight of 329.48 g/mol. Its IUPAC name is 4-[[3-(1,1-difluoroethyl)-1H-pyrazol-5-yl]methyl]-1-methylpiperidine;hexane.
Molecular Properties
| Compound Name | 4-[[3-(1,1-difluoroethyl)-1H-pyrazol-5-yl]methyl]-1-methylpiperidine;hexane |
| PubChem CID | 142021337 |
| Molecular Formula | C18H33F2N3 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.26 |
| IUPAC Name | 4-[[3-(1,1-difluoroethyl)-1H-pyrazol-5-yl]methyl]-1-methylpiperidine;hexane |
| SMILES | CCCCCC.CN1CCC(Cc2cc(C(C)(F)F)n[nH]2)CC1 |
| InChI | InChI=1S/C12H19F2N3.C6H14/c1-12(13,14)11-8-10(15-16-11)7-9-3-5-17(2)6-4-9;1-3-5-6-4-2/h8-9H,3-7H2,1-2H3,(H,15,16);3-6H2,1-2H3 |
| InChIKey | CXNBQGYBBRMCDJ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[[3-(1,1-difluoroethyl)-1H-pyrazol-5-yl]methyl]-1-methylpiperidine;hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3-(1,1-difluoroethyl)-1H-pyrazol-5-yl]methyl]-1-methylpiperidine;hexane?
The IUPAC name of 4-[[3-(1,1-difluoroethyl)-1H-pyrazol-5-yl]methyl]-1-methylpiperidine;hexane (CID 142021337) is 4-[[3-(1,1-difluoroethyl)-1H-pyrazol-5-yl]methyl]-1-methylpiperidine;hexane.
What is the SMILES notation for 4-[[3-(1,1-difluoroethyl)-1H-pyrazol-5-yl]methyl]-1-methylpiperidine;hexane?
The canonical SMILES for 4-[[3-(1,1-difluoroethyl)-1H-pyrazol-5-yl]methyl]-1-methylpiperidine;hexane is CCCCCC.CN1CCC(Cc2cc(C(C)(F)F)n[nH]2)CC1.
What is the InChIKey of 4-[[3-(1,1-difluoroethyl)-1H-pyrazol-5-yl]methyl]-1-methylpiperidine;hexane?
The InChIKey is CXNBQGYBBRMCDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19F2N3.C6H14/c1-12(13,14)11-8-10(15-16-11)7-9-3-5-17(2)6-4-9;1-3-5-6-4-2/h8-9H,3-7H2,1-2H3,(H,15,16);3-6H2,1-2H3.
What are the key properties of 4-[[3-(1,1-difluoroethyl)-1H-pyrazol-5-yl]methyl]-1-methylpiperidine;hexane?
4-[[3-(1,1-difluoroethyl)-1H-pyrazol-5-yl]methyl]-1-methylpiperidine;hexane has a molecular weight of 329.48 g/mol, XLogP of 4.99, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3-(1,1-difluoroethyl)-1H-pyrazol-5-yl]methyl]-1-methylpiperidine;hexane is sourced from PubChem (CID 142021337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).