C35H54N4O3 — CID 142021599
benzene;3-benzyl-1-[1-[[(3S)-1-(1-cyclohexylethyl)pyrrolidin-3-yl]methyl]piperidin-4-yl]-1-ethylurea;formic acid (PubChem CID 142021599) has the molecular formula C35H54N4O3 and a molecular weight of 578.84 g/mol. Its IUPAC name is benzene;3-benzyl-1-[1-[[(3S)-1-(1-cyclohexylethyl)pyrrolidin-3-yl]methyl]piperidin-4-yl]-1-ethylurea;formic acid.
| Compound Name | benzene;3-benzyl-1-[1-[[(3S)-1-(1-cyclohexylethyl)pyrrolidin-3-yl]methyl]piperidin-4-yl]-1-ethylurea;formic acid |
|---|---|
| PubChem CID | 142021599 |
| Molecular Formula | C35H54N4O3 |
| Molecular Weight | 578.84 g/mol |
| Exact Mass | 578.42 |
| IUPAC Name | benzene;3-benzyl-1-[1-[[(3S)-1-(1-cyclohexylethyl)pyrrolidin-3-yl]methyl]piperidin-4-yl]-1-ethylurea;formic acid |
| SMILES | CCN(C(=O)NCc1ccccc1)C1CCN(C[C@@H]2CCN(C(C)C3CCCCC3)C2)CC1.O=CO.c1ccccc1 |
| InChI | InChI=1S/C28H46N4O.C6H6.CH2O2/c1-3-32(28(33)29-20-24-10-6-4-7-11-24)27-15-17-30(18-16-27)21-25-14-19-31(22-25)23(2)26-12-8-5-9-13-26;1-2-4-6-5-3-1;2-1-3/h4,6-7,10-11,23,25-27H,3,5,8-9,12-22H2,1-2H3,(H,29,33);1-6H;1H,(H,2,3)/t23?,25-;;/m0../s1 |
| InChIKey | ZANWXGPYMZFUJA-KZAJZZAJSA-N |
| XLogP | 6.36 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.84 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|