C26H31N3O4Si — CID 142022498
8-(1-amino-2-trimethylsilylethyl)-19-ethyl-19-(hydroxymethyl)-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione (PubChem CID 142022498) has the molecular formula C26H31N3O4Si and a molecular weight of 477.64 g/mol. Its IUPAC name is 8-(1-amino-2-trimethylsilylethyl)-19-ethyl-19-(hydroxymethyl)-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione.
| Compound Name | 8-(1-amino-2-trimethylsilylethyl)-19-ethyl-19-(hydroxymethyl)-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione |
|---|---|
| PubChem CID | 142022498 |
| Molecular Formula | C26H31N3O4Si |
| Molecular Weight | 477.64 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | 8-(1-amino-2-trimethylsilylethyl)-19-ethyl-19-(hydroxymethyl)-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione |
| SMILES | CCC1(CO)C(=O)OCc2c1cc1n(c2=O)Cc2cc3c(C(N)C[Si](C)(C)C)cccc3nc2-1 |
| InChI | InChI=1S/C26H31N3O4Si/c1-5-26(14-30)19-10-22-23-15(11-29(22)24(31)18(19)12-33-25(26)32)9-17-16(7-6-8-21(17)28-23)20(27)13-34(2,3)4/h6-10,20,30H,5,11-14,27H2,1-4H3 |
| InChIKey | AVJYBUODJFHVGI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.64 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|