C17H25N3O5 — CID 142022844
[2-(2-morpholin-4-ylethylcarbamoyloxymethyl)phenyl]methyl N-methylcarbamate (PubChem CID 142022844) has the molecular formula C17H25N3O5 and a molecular weight of 351.40 g/mol. Its IUPAC name is [2-(2-morpholin-4-ylethylcarbamoyloxymethyl)phenyl]methyl N-methylcarbamate.
| Compound Name | [2-(2-morpholin-4-ylethylcarbamoyloxymethyl)phenyl]methyl N-methylcarbamate |
|---|---|
| PubChem CID | 142022844 |
| Molecular Formula | C17H25N3O5 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | [2-(2-morpholin-4-ylethylcarbamoyloxymethyl)phenyl]methyl N-methylcarbamate |
| SMILES | CNC(=O)OCc1ccccc1COC(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C17H25N3O5/c1-18-16(21)24-12-14-4-2-3-5-15(14)13-25-17(22)19-6-7-20-8-10-23-11-9-20/h2-5H,6-13H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | VBHLXGAXAHGXTG-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |