About ethane;N-[2-[ethyl(methyl)amino]ethyl]-N-methyl-N'-[(Z)-prop-1-enyl]ethanimidamide
ethane;N-[2-[ethyl(methyl)amino]ethyl]-N-methyl-N'-[(Z)-prop-1-enyl]ethanimidamide (PubChem CID 142022936) has the molecular formula C13H29N3
and a molecular weight of 227.40 g/mol. Its IUPAC name is ethane;N-[2-[ethyl(methyl)amino]ethyl]-N-methyl-N'-[(Z)-prop-1-enyl]ethanimidamide.
Molecular Properties
| Compound Name | ethane;N-[2-[ethyl(methyl)amino]ethyl]-N-methyl-N'-[(Z)-prop-1-enyl]ethanimidamide |
| PubChem CID | 142022936 |
| Molecular Formula | C13H29N3 |
| Molecular Weight | 227.40 g/mol |
| Exact Mass | 227.24 |
| IUPAC Name | ethane;N-[2-[ethyl(methyl)amino]ethyl]-N-methyl-N'-[(Z)-prop-1-enyl]ethanimidamide |
| SMILES | C/C=C\N=C(/C)N(C)CCN(C)CC.CC |
| InChI | InChI=1S/C11H23N3.C2H6/c1-6-8-12-11(3)14(5)10-9-13(4)7-2;1-2/h6,8H,7,9-10H2,1-5H3;1-2H3/b8-6-,12-11+; |
| InChIKey | DENIDQMZVCNJQY-PDNORIGOSA-N |
| XLogP | 2.85 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-[2-[ethyl(methyl)amino]ethyl]-N-methyl-N'-[(Z)-prop-1-enyl]ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-[2-[ethyl(methyl)amino]ethyl]-N-methyl-N'-[(Z)-prop-1-enyl]ethanimidamide?
The IUPAC name of ethane;N-[2-[ethyl(methyl)amino]ethyl]-N-methyl-N'-[(Z)-prop-1-enyl]ethanimidamide (CID 142022936) is ethane;N-[2-[ethyl(methyl)amino]ethyl]-N-methyl-N'-[(Z)-prop-1-enyl]ethanimidamide.
What is the SMILES notation for ethane;N-[2-[ethyl(methyl)amino]ethyl]-N-methyl-N'-[(Z)-prop-1-enyl]ethanimidamide?
The canonical SMILES for ethane;N-[2-[ethyl(methyl)amino]ethyl]-N-methyl-N'-[(Z)-prop-1-enyl]ethanimidamide is C/C=C\N=C(/C)N(C)CCN(C)CC.CC.
What is the InChIKey of ethane;N-[2-[ethyl(methyl)amino]ethyl]-N-methyl-N'-[(Z)-prop-1-enyl]ethanimidamide?
The InChIKey is DENIDQMZVCNJQY-PDNORIGOSA-N. The full InChI is InChI=1S/C11H23N3.C2H6/c1-6-8-12-11(3)14(5)10-9-13(4)7-2;1-2/h6,8H,7,9-10H2,1-5H3;1-2H3/b8-6-,12-11+;.
What are the key properties of ethane;N-[2-[ethyl(methyl)amino]ethyl]-N-methyl-N'-[(Z)-prop-1-enyl]ethanimidamide?
ethane;N-[2-[ethyl(methyl)amino]ethyl]-N-methyl-N'-[(Z)-prop-1-enyl]ethanimidamide has a molecular weight of 227.40 g/mol, XLogP of 2.85, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-[2-[ethyl(methyl)amino]ethyl]-N-methyl-N'-[(Z)-prop-1-enyl]ethanimidamide is sourced from PubChem (CID 142022936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).