C17H30IN3O — CID 142022952
N'-(1-tert-butylazetidin-3-yl)-N'-iodo-N-(4-methoxycyclohexa-1,3-dien-1-yl)-N-methylethane-1,2-diamine (PubChem CID 142022952) has the molecular formula C17H30IN3O and a molecular weight of 419.35 g/mol. Its IUPAC name is N'-(1-tert-butylazetidin-3-yl)-N'-iodo-N-(4-methoxycyclohexa-1,3-dien-1-yl)-N-methylethane-1,2-diamine.
| Compound Name | N'-(1-tert-butylazetidin-3-yl)-N'-iodo-N-(4-methoxycyclohexa-1,3-dien-1-yl)-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 142022952 |
| Molecular Formula | C17H30IN3O |
| Molecular Weight | 419.35 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | N'-(1-tert-butylazetidin-3-yl)-N'-iodo-N-(4-methoxycyclohexa-1,3-dien-1-yl)-N-methylethane-1,2-diamine |
| SMILES | COC1=CC=C(N(C)CCN(I)C2CN(C(C)(C)C)C2)CC1 |
| InChI | InChI=1S/C17H30IN3O/c1-17(2,3)20-12-15(13-20)21(18)11-10-19(4)14-6-8-16(22-5)9-7-14/h6,8,15H,7,9-13H2,1-5H3 |
| InChIKey | HQNXRMBJGKPXSB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|