About 1-(bromomethyl)-4-(1-methylcyclopentyl)benzene;formaldehyde;2-methylpropan-2-ol
1-(bromomethyl)-4-(1-methylcyclopentyl)benzene;formaldehyde;2-methylpropan-2-ol (PubChem CID 142022992) has the molecular formula C18H29BrO2
and a molecular weight of 357.33 g/mol. Its IUPAC name is 1-(bromomethyl)-4-(1-methylcyclopentyl)benzene;formaldehyde;2-methylpropan-2-ol.
Molecular Properties
| Compound Name | 1-(bromomethyl)-4-(1-methylcyclopentyl)benzene;formaldehyde;2-methylpropan-2-ol |
| PubChem CID | 142022992 |
| Molecular Formula | C18H29BrO2 |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 1-(bromomethyl)-4-(1-methylcyclopentyl)benzene;formaldehyde;2-methylpropan-2-ol |
| SMILES | C=O.CC(C)(C)O.CC1(c2ccc(CBr)cc2)CCCC1 |
| InChI | InChI=1S/C13H17Br.C4H10O.CH2O/c1-13(8-2-3-9-13)12-6-4-11(10-14)5-7-12;1-4(2,3)5;1-2/h4-7H,2-3,8-10H2,1H3;5H,1-3H3;1H2 |
| InChIKey | UZFICOPTPXLIRJ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(bromomethyl)-4-(1-methylcyclopentyl)benzene;formaldehyde;2-methylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(bromomethyl)-4-(1-methylcyclopentyl)benzene;formaldehyde;2-methylpropan-2-ol?
The IUPAC name of 1-(bromomethyl)-4-(1-methylcyclopentyl)benzene;formaldehyde;2-methylpropan-2-ol (CID 142022992) is 1-(bromomethyl)-4-(1-methylcyclopentyl)benzene;formaldehyde;2-methylpropan-2-ol.
What is the SMILES notation for 1-(bromomethyl)-4-(1-methylcyclopentyl)benzene;formaldehyde;2-methylpropan-2-ol?
The canonical SMILES for 1-(bromomethyl)-4-(1-methylcyclopentyl)benzene;formaldehyde;2-methylpropan-2-ol is C=O.CC(C)(C)O.CC1(c2ccc(CBr)cc2)CCCC1.
What is the InChIKey of 1-(bromomethyl)-4-(1-methylcyclopentyl)benzene;formaldehyde;2-methylpropan-2-ol?
The InChIKey is UZFICOPTPXLIRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17Br.C4H10O.CH2O/c1-13(8-2-3-9-13)12-6-4-11(10-14)5-7-12;1-4(2,3)5;1-2/h4-7H,2-3,8-10H2,1H3;5H,1-3H3;1H2.
What are the key properties of 1-(bromomethyl)-4-(1-methylcyclopentyl)benzene;formaldehyde;2-methylpropan-2-ol?
1-(bromomethyl)-4-(1-methylcyclopentyl)benzene;formaldehyde;2-methylpropan-2-ol has a molecular weight of 357.33 g/mol, XLogP of 5.01, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(bromomethyl)-4-(1-methylcyclopentyl)benzene;formaldehyde;2-methylpropan-2-ol is sourced from PubChem (CID 142022992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).