About N-[(2E)-4-(cyclohexylmethylamino)-3-methylpenta-2,4-dien-2-yl]-N'-methylethanimidamide
N-[(2E)-4-(cyclohexylmethylamino)-3-methylpenta-2,4-dien-2-yl]-N'-methylethanimidamide (PubChem CID 142023123) has the molecular formula C16H29N3
and a molecular weight of 263.43 g/mol. Its IUPAC name is N-[(2E)-4-(cyclohexylmethylamino)-3-methylpenta-2,4-dien-2-yl]-N'-methylethanimidamide.
Molecular Properties
| Compound Name | N-[(2E)-4-(cyclohexylmethylamino)-3-methylpenta-2,4-dien-2-yl]-N'-methylethanimidamide |
| PubChem CID | 142023123 |
| Molecular Formula | C16H29N3 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.24 |
| IUPAC Name | N-[(2E)-4-(cyclohexylmethylamino)-3-methylpenta-2,4-dien-2-yl]-N'-methylethanimidamide |
| SMILES | C=C(NCC1CCCCC1)/C(C)=C(\C)N/C(C)=N/C |
| InChI | InChI=1S/C16H29N3/c1-12(14(3)19-15(4)17-5)13(2)18-11-16-9-7-6-8-10-16/h16,18H,2,6-11H2,1,3-5H3,(H,17,19)/b14-12+ |
| InChIKey | JQLFAFXGRLJTCF-WYMLVPIESA-N |
| XLogP | 3.60 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2E)-4-(cyclohexylmethylamino)-3-methylpenta-2,4-dien-2-yl]-N'-methylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2E)-4-(cyclohexylmethylamino)-3-methylpenta-2,4-dien-2-yl]-N'-methylethanimidamide?
The IUPAC name of N-[(2E)-4-(cyclohexylmethylamino)-3-methylpenta-2,4-dien-2-yl]-N'-methylethanimidamide (CID 142023123) is N-[(2E)-4-(cyclohexylmethylamino)-3-methylpenta-2,4-dien-2-yl]-N'-methylethanimidamide.
What is the SMILES notation for N-[(2E)-4-(cyclohexylmethylamino)-3-methylpenta-2,4-dien-2-yl]-N'-methylethanimidamide?
The canonical SMILES for N-[(2E)-4-(cyclohexylmethylamino)-3-methylpenta-2,4-dien-2-yl]-N'-methylethanimidamide is C=C(NCC1CCCCC1)/C(C)=C(\C)N/C(C)=N/C.
What is the InChIKey of N-[(2E)-4-(cyclohexylmethylamino)-3-methylpenta-2,4-dien-2-yl]-N'-methylethanimidamide?
The InChIKey is JQLFAFXGRLJTCF-WYMLVPIESA-N. The full InChI is InChI=1S/C16H29N3/c1-12(14(3)19-15(4)17-5)13(2)18-11-16-9-7-6-8-10-16/h16,18H,2,6-11H2,1,3-5H3,(H,17,19)/b14-12+.
What are the key properties of N-[(2E)-4-(cyclohexylmethylamino)-3-methylpenta-2,4-dien-2-yl]-N'-methylethanimidamide?
N-[(2E)-4-(cyclohexylmethylamino)-3-methylpenta-2,4-dien-2-yl]-N'-methylethanimidamide has a molecular weight of 263.43 g/mol, XLogP of 3.60, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2E)-4-(cyclohexylmethylamino)-3-methylpenta-2,4-dien-2-yl]-N'-methylethanimidamide is sourced from PubChem (CID 142023123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).