C27H45FO — CID 142023816
1-[(3S)-3-fluorooctoxy]-4-[2-(4-pentylcyclohexyl)ethyl]benzene (PubChem CID 142023816) has the molecular formula C27H45FO and a molecular weight of 404.65 g/mol. Its IUPAC name is 1-[(3S)-3-fluorooctoxy]-4-[2-(4-pentylcyclohexyl)ethyl]benzene.
| Compound Name | 1-[(3S)-3-fluorooctoxy]-4-[2-(4-pentylcyclohexyl)ethyl]benzene |
|---|---|
| PubChem CID | 142023816 |
| Molecular Formula | C27H45FO |
| Molecular Weight | 404.65 g/mol |
| Exact Mass | 404.35 |
| IUPAC Name | 1-[(3S)-3-fluorooctoxy]-4-[2-(4-pentylcyclohexyl)ethyl]benzene |
| SMILES | CCCCCC1CCC(CCc2ccc(OCC[C@@H](F)CCCCC)cc2)CC1 |
| InChI | InChI=1S/C27H45FO/c1-3-5-7-9-23-11-13-24(14-12-23)15-16-25-17-19-27(20-18-25)29-22-21-26(28)10-8-6-4-2/h17-20,23-24,26H,3-16,21-22H2,1-2H3/t23?,24?,26-/m0/s1 |
| InChIKey | ZZYSLLIXSMABFR-RSMFLLDRSA-N |
| XLogP | 8.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.65 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|