About CID 142023832
CID 142023832 (PubChem CID 142023832) has the molecular formula C6H9N2
and a molecular weight of 109.15 g/mol.
Molecular Properties
| Compound Name | CID 142023832 |
| PubChem CID | 142023832 |
| Molecular Formula | C6H9N2 |
| Molecular Weight | 109.15 g/mol |
| Exact Mass | 109.08 |
| IUPAC Name | — |
| SMILES | CC1=CN=C(C)[CH]N1 |
| InChI | InChI=1S/C6H9N2/c1-5-3-8-6(2)4-7-5/h3-4,7H,1-2H3 |
| InChIKey | OPHSJDAYRRYOJY-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.15 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 142023832 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 142023832?
The IUPAC name of CID 142023832 (CID 142023832) is not available.
What is the SMILES notation for CID 142023832?
The canonical SMILES for CID 142023832 is CC1=CN=C(C)[CH]N1.
What is the InChIKey of CID 142023832?
The InChIKey is OPHSJDAYRRYOJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N2/c1-5-3-8-6(2)4-7-5/h3-4,7H,1-2H3.
What are the key properties of CID 142023832?
CID 142023832 has a molecular weight of 109.15 g/mol, XLogP of 1.07, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 142023832 is sourced from PubChem (CID 142023832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).