About heptane-3,5-diimine
heptane-3,5-diimine (PubChem CID 142023911) has the molecular formula C7H14N2
and a molecular weight of 126.20 g/mol. Its IUPAC name is heptane-3,5-diimine.
Molecular Properties
| Compound Name | heptane-3,5-diimine |
| PubChem CID | 142023911 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | heptane-3,5-diimine |
| SMILES | [H]/N=C(\CC)C/C(CC)=N/[H] |
| InChI | InChI=1S/C7H14N2/c1-3-6(8)5-7(9)4-2/h8-9H,3-5H2,1-2H3/b8-6+,9-7+ |
| InChIKey | GSJMBLOVRLLLFI-CDJQDVQCSA-N |
| XLogP | 2.24 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze heptane-3,5-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptane-3,5-diimine?
The IUPAC name of heptane-3,5-diimine (CID 142023911) is heptane-3,5-diimine.
What is the SMILES notation for heptane-3,5-diimine?
The canonical SMILES for heptane-3,5-diimine is [H]/N=C(\CC)C/C(CC)=N/[H].
What is the InChIKey of heptane-3,5-diimine?
The InChIKey is GSJMBLOVRLLLFI-CDJQDVQCSA-N. The full InChI is InChI=1S/C7H14N2/c1-3-6(8)5-7(9)4-2/h8-9H,3-5H2,1-2H3/b8-6+,9-7+.
What are the key properties of heptane-3,5-diimine?
heptane-3,5-diimine has a molecular weight of 126.20 g/mol, XLogP of 2.24, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for heptane-3,5-diimine is sourced from PubChem (CID 142023911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).