C25H35NO — CID 142024038
(3E,5Z)-N-[(Z)-1-[(3E,5Z,8E,10E)-dodeca-1,3,5,8,10-pentaen-4-yl]oxypent-3-en-2-yl]-4-methylhepta-1,3,5-trien-3-amine (PubChem CID 142024038) has the molecular formula C25H35NO and a molecular weight of 365.56 g/mol. Its IUPAC name is (3E,5Z)-N-[(Z)-1-[(3E,5Z,8E,10E)-dodeca-1,3,5,8,10-pentaen-4-yl]oxypent-3-en-2-yl]-4-methylhepta-1,3,5-trien-3-amine.
| Compound Name | (3E,5Z)-N-[(Z)-1-[(3E,5Z,8E,10E)-dodeca-1,3,5,8,10-pentaen-4-yl]oxypent-3-en-2-yl]-4-methylhepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 142024038 |
| Molecular Formula | C25H35NO |
| Molecular Weight | 365.56 g/mol |
| Exact Mass | 365.27 |
| IUPAC Name | (3E,5Z)-N-[(Z)-1-[(3E,5Z,8E,10E)-dodeca-1,3,5,8,10-pentaen-4-yl]oxypent-3-en-2-yl]-4-methylhepta-1,3,5-trien-3-amine |
| SMILES | C=C/C=C(\C=C/C/C=C/C=C/C)OCC(/C=C\C)N/C(C=C)=C(C)/C=C\C |
| InChI | InChI=1S/C25H35NO/c1-7-12-13-14-15-16-20-24(19-10-4)27-21-23(18-9-3)26-25(11-5)22(6)17-8-2/h7-14,16-20,23,26H,4-5,15,21H2,1-3,6H3/b12-7+,14-13+,17-8-,18-9-,20-16-,24-19+,25-22+ |
| InChIKey | NIDUHGZCISTOTB-VAUJLMPWSA-N |
| XLogP | 6.72 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.56 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|