About (5S)-2,5-dimethylcyclohex-2-en-1-one;ethane
(5S)-2,5-dimethylcyclohex-2-en-1-one;ethane (PubChem CID 142025260) has the molecular formula C10H18O
and a molecular weight of 154.25 g/mol. Its IUPAC name is (5S)-2,5-dimethylcyclohex-2-en-1-one;ethane.
Molecular Properties
| Compound Name | (5S)-2,5-dimethylcyclohex-2-en-1-one;ethane |
| PubChem CID | 142025260 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | (5S)-2,5-dimethylcyclohex-2-en-1-one;ethane |
| SMILES | CC.CC1=CC[C@H](C)CC1=O |
| InChI | InChI=1S/C8H12O.C2H6/c1-6-3-4-7(2)8(9)5-6;1-2/h4,6H,3,5H2,1-2H3;1-2H3/t6-;/m0./s1 |
| InChIKey | PEAAJKJMFIIXKQ-RGMNGODLSA-N |
| XLogP | 2.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (5S)-2,5-dimethylcyclohex-2-en-1-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-2,5-dimethylcyclohex-2-en-1-one;ethane?
The IUPAC name of (5S)-2,5-dimethylcyclohex-2-en-1-one;ethane (CID 142025260) is (5S)-2,5-dimethylcyclohex-2-en-1-one;ethane.
What is the SMILES notation for (5S)-2,5-dimethylcyclohex-2-en-1-one;ethane?
The canonical SMILES for (5S)-2,5-dimethylcyclohex-2-en-1-one;ethane is CC.CC1=CC[C@H](C)CC1=O.
What is the InChIKey of (5S)-2,5-dimethylcyclohex-2-en-1-one;ethane?
The InChIKey is PEAAJKJMFIIXKQ-RGMNGODLSA-N. The full InChI is InChI=1S/C8H12O.C2H6/c1-6-3-4-7(2)8(9)5-6;1-2/h4,6H,3,5H2,1-2H3;1-2H3/t6-;/m0./s1.
What are the key properties of (5S)-2,5-dimethylcyclohex-2-en-1-one;ethane?
(5S)-2,5-dimethylcyclohex-2-en-1-one;ethane has a molecular weight of 154.25 g/mol, XLogP of 2.96, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-2,5-dimethylcyclohex-2-en-1-one;ethane is sourced from PubChem (CID 142025260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).