About (5Z)-2-ethoxy-7-methoxy-N-methyl-4-methylideneocta-5,7-dienamide
(5Z)-2-ethoxy-7-methoxy-N-methyl-4-methylideneocta-5,7-dienamide (PubChem CID 142025348) has the molecular formula C13H21NO3
and a molecular weight of 239.31 g/mol. Its IUPAC name is (5Z)-2-ethoxy-7-methoxy-N-methyl-4-methylideneocta-5,7-dienamide.
Molecular Properties
| Compound Name | (5Z)-2-ethoxy-7-methoxy-N-methyl-4-methylideneocta-5,7-dienamide |
| PubChem CID | 142025348 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | (5Z)-2-ethoxy-7-methoxy-N-methyl-4-methylideneocta-5,7-dienamide |
| SMILES | C=C(/C=C\C(=C)OC)CC(OCC)C(=O)NC |
| InChI | InChI=1S/C13H21NO3/c1-6-17-12(13(15)14-4)9-10(2)7-8-11(3)16-5/h7-8,12H,2-3,6,9H2,1,4-5H3,(H,14,15)/b8-7- |
| InChIKey | JBQITSNTGWVFRZ-FPLPWBNLSA-N |
| XLogP | 1.80 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (5Z)-2-ethoxy-7-methoxy-N-methyl-4-methylideneocta-5,7-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-2-ethoxy-7-methoxy-N-methyl-4-methylideneocta-5,7-dienamide?
The IUPAC name of (5Z)-2-ethoxy-7-methoxy-N-methyl-4-methylideneocta-5,7-dienamide (CID 142025348) is (5Z)-2-ethoxy-7-methoxy-N-methyl-4-methylideneocta-5,7-dienamide.
What is the SMILES notation for (5Z)-2-ethoxy-7-methoxy-N-methyl-4-methylideneocta-5,7-dienamide?
The canonical SMILES for (5Z)-2-ethoxy-7-methoxy-N-methyl-4-methylideneocta-5,7-dienamide is C=C(/C=C\C(=C)OC)CC(OCC)C(=O)NC.
What is the InChIKey of (5Z)-2-ethoxy-7-methoxy-N-methyl-4-methylideneocta-5,7-dienamide?
The InChIKey is JBQITSNTGWVFRZ-FPLPWBNLSA-N. The full InChI is InChI=1S/C13H21NO3/c1-6-17-12(13(15)14-4)9-10(2)7-8-11(3)16-5/h7-8,12H,2-3,6,9H2,1,4-5H3,(H,14,15)/b8-7-.
What are the key properties of (5Z)-2-ethoxy-7-methoxy-N-methyl-4-methylideneocta-5,7-dienamide?
(5Z)-2-ethoxy-7-methoxy-N-methyl-4-methylideneocta-5,7-dienamide has a molecular weight of 239.31 g/mol, XLogP of 1.80, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-2-ethoxy-7-methoxy-N-methyl-4-methylideneocta-5,7-dienamide is sourced from PubChem (CID 142025348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).