About CID 142025350
CID 142025350 (PubChem CID 142025350) has the molecular formula C9H12NO
and a molecular weight of 150.20 g/mol.
Molecular Properties
| Compound Name | CID 142025350 |
| PubChem CID | 142025350 |
| Molecular Formula | C9H12NO |
| Molecular Weight | 150.20 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | — |
| SMILES | CN1CCOC2C=C[CH]C=C21 |
| InChI | InChI=1S/C9H12NO/c1-10-6-7-11-9-5-3-2-4-8(9)10/h2-5,9H,6-7H2,1H3 |
| InChIKey | HKCZIKZLROXTBI-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.20 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 142025350 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 142025350?
The IUPAC name of CID 142025350 (CID 142025350) is not available.
What is the SMILES notation for CID 142025350?
The canonical SMILES for CID 142025350 is CN1CCOC2C=C[CH]C=C21.
What is the InChIKey of CID 142025350?
The InChIKey is HKCZIKZLROXTBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12NO/c1-10-6-7-11-9-5-3-2-4-8(9)10/h2-5,9H,6-7H2,1H3.
What are the key properties of CID 142025350?
CID 142025350 has a molecular weight of 150.20 g/mol, XLogP of 0.97, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 142025350 is sourced from PubChem (CID 142025350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).