C9H5N3OS3 — CID 142025665
4-oxo-7,8-bis(sulfanyl)-6-sulfanylidene-1,5-dihydro-1,5-naphthyridine-3-carbonitrile (PubChem CID 142025665) has the molecular formula C9H5N3OS3 and a molecular weight of 267.36 g/mol. Its IUPAC name is 4-oxo-7,8-bis(sulfanyl)-6-sulfanylidene-1,5-dihydro-1,5-naphthyridine-3-carbonitrile.
| Compound Name | 4-oxo-7,8-bis(sulfanyl)-6-sulfanylidene-1,5-dihydro-1,5-naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 142025665 |
| Molecular Formula | C9H5N3OS3 |
| Molecular Weight | 267.36 g/mol |
| Exact Mass | 266.96 |
| IUPAC Name | 4-oxo-7,8-bis(sulfanyl)-6-sulfanylidene-1,5-dihydro-1,5-naphthyridine-3-carbonitrile |
| SMILES | N#Cc1c[nH]c2c(S)c(S)c(=S)[nH]c2c1=O |
| InChI | InChI=1S/C9H5N3OS3/c10-1-3-2-11-5-4(6(3)13)12-9(16)8(15)7(5)14/h2,15H,(H,11,13)(H2,12,14,16) |
| InChIKey | YTXMAJSHHNLFGW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.36 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|