C22H34O2 — CID 142026019
(1S,3Z,4E)-4-ethylidene-3-[(2E)-2-[1-[(1S)-1-hydroxyethyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]cyclohexan-1-ol (PubChem CID 142026019) has the molecular formula C22H34O2 and a molecular weight of 330.51 g/mol. Its IUPAC name is (1S,3Z,4E)-4-ethylidene-3-[(2E)-2-[1-[(1S)-1-hydroxyethyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]cyclohexan-1-ol.
| Compound Name | (1S,3Z,4E)-4-ethylidene-3-[(2E)-2-[1-[(1S)-1-hydroxyethyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]cyclohexan-1-ol |
|---|---|
| PubChem CID | 142026019 |
| Molecular Formula | C22H34O2 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.26 |
| IUPAC Name | (1S,3Z,4E)-4-ethylidene-3-[(2E)-2-[1-[(1S)-1-hydroxyethyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]cyclohexan-1-ol |
| SMILES | C/C=C1\CC[C@H](O)C\C1=C\C=C1/CCCC2(C)C1CCC2[C@H](C)O |
| InChI | InChI=1S/C22H34O2/c1-4-16-9-10-19(24)14-18(16)8-7-17-6-5-13-22(3)20(15(2)23)11-12-21(17)22/h4,7-8,15,19-21,23-24H,5-6,9-14H2,1-3H3/b16-4+,17-7+,18-8-/t15-,19-,20?,21?,22?/m0/s1 |
| InChIKey | YRJFJGFGGMOOCD-PTUKYZCVSA-N |
| XLogP | 4.93 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |