About (E)-but-2-ene;2-(3-methyl-4-pent-4-en-2-ylphenyl)prop-1-en-1-one;propane
(E)-but-2-ene;2-(3-methyl-4-pent-4-en-2-ylphenyl)prop-1-en-1-one;propane (PubChem CID 142026201) has the molecular formula C22H34O
and a molecular weight of 314.51 g/mol. Its IUPAC name is (E)-but-2-ene;2-(3-methyl-4-pent-4-en-2-ylphenyl)prop-1-en-1-one;propane.
Molecular Properties
| Compound Name | (E)-but-2-ene;2-(3-methyl-4-pent-4-en-2-ylphenyl)prop-1-en-1-one;propane |
| PubChem CID | 142026201 |
| Molecular Formula | C22H34O |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | (E)-but-2-ene;2-(3-methyl-4-pent-4-en-2-ylphenyl)prop-1-en-1-one;propane |
| SMILES | C/C=C/C.C=CCC(C)c1ccc(C(C)=C=O)cc1C.CCC |
| InChI | InChI=1S/C15H18O.C4H8.C3H8/c1-5-6-11(2)15-8-7-14(9-12(15)3)13(4)10-16;1-3-4-2;1-3-2/h5,7-9,11H,1,6H2,2-4H3;3-4H,1-2H3;3H2,1-2H3/b;4-3+; |
| InChIKey | PDWDTFQFXZPDHN-ITDJAWRYSA-N |
| XLogP | 6.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-ene;2-(3-methyl-4-pent-4-en-2-ylphenyl)prop-1-en-1-one;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-ene;2-(3-methyl-4-pent-4-en-2-ylphenyl)prop-1-en-1-one;propane?
The IUPAC name of (E)-but-2-ene;2-(3-methyl-4-pent-4-en-2-ylphenyl)prop-1-en-1-one;propane (CID 142026201) is (E)-but-2-ene;2-(3-methyl-4-pent-4-en-2-ylphenyl)prop-1-en-1-one;propane.
What is the SMILES notation for (E)-but-2-ene;2-(3-methyl-4-pent-4-en-2-ylphenyl)prop-1-en-1-one;propane?
The canonical SMILES for (E)-but-2-ene;2-(3-methyl-4-pent-4-en-2-ylphenyl)prop-1-en-1-one;propane is C/C=C/C.C=CCC(C)c1ccc(C(C)=C=O)cc1C.CCC.
What is the InChIKey of (E)-but-2-ene;2-(3-methyl-4-pent-4-en-2-ylphenyl)prop-1-en-1-one;propane?
The InChIKey is PDWDTFQFXZPDHN-ITDJAWRYSA-N. The full InChI is InChI=1S/C15H18O.C4H8.C3H8/c1-5-6-11(2)15-8-7-14(9-12(15)3)13(4)10-16;1-3-4-2;1-3-2/h5,7-9,11H,1,6H2,2-4H3;3-4H,1-2H3;3H2,1-2H3/b;4-3+;.
What are the key properties of (E)-but-2-ene;2-(3-methyl-4-pent-4-en-2-ylphenyl)prop-1-en-1-one;propane?
(E)-but-2-ene;2-(3-methyl-4-pent-4-en-2-ylphenyl)prop-1-en-1-one;propane has a molecular weight of 314.51 g/mol, XLogP of 6.91, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-ene;2-(3-methyl-4-pent-4-en-2-ylphenyl)prop-1-en-1-one;propane is sourced from PubChem (CID 142026201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).