C35H41Cl3O2 — CID 142026228
4-chloro-1-methyl-2-pent-4-en-2-ylbenzene;3-[2-(3,4-dichlorophenyl)ethyl]-4-[(Z)-3,4-dimethylhex-3-enyl]benzoic acid (PubChem CID 142026228) has the molecular formula C35H41Cl3O2 and a molecular weight of 600.07 g/mol. Its IUPAC name is 4-chloro-1-methyl-2-pent-4-en-2-ylbenzene;3-[2-(3,4-dichlorophenyl)ethyl]-4-[(Z)-3,4-dimethylhex-3-enyl]benzoic acid.
| Compound Name | 4-chloro-1-methyl-2-pent-4-en-2-ylbenzene;3-[2-(3,4-dichlorophenyl)ethyl]-4-[(Z)-3,4-dimethylhex-3-enyl]benzoic acid |
|---|---|
| PubChem CID | 142026228 |
| Molecular Formula | C35H41Cl3O2 |
| Molecular Weight | 600.07 g/mol |
| Exact Mass | 598.22 |
| IUPAC Name | 4-chloro-1-methyl-2-pent-4-en-2-ylbenzene;3-[2-(3,4-dichlorophenyl)ethyl]-4-[(Z)-3,4-dimethylhex-3-enyl]benzoic acid |
| SMILES | C=CCC(C)c1cc(Cl)ccc1C.CC/C(C)=C(/C)CCc1ccc(C(=O)O)cc1CCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H26Cl2O2.C12H15Cl/c1-4-15(2)16(3)5-8-18-10-11-20(23(26)27)14-19(18)9-6-17-7-12-21(24)22(25)13-17;1-4-5-9(2)12-8-11(13)7-6-10(12)3/h7,10-14H,4-6,8-9H2,1-3H3,(H,26,27);4,6-9H,1,5H2,2-3H3/b16-15-; |
| InChIKey | BKIWMPBFQKNSCY-YFKNTREVSA-N |
| XLogP | 11.48 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.07 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|