C17H18NO6PS — CID 142026651
5-amino-5-(2-methylsulfanylethyl)-3-oxo-3-phenoxy-2,4,7-trioxa-3λ5-phosphabicyclo[6.2.2]dodeca-1(10),8,11-trien-6-one (PubChem CID 142026651) has the molecular formula C17H18NO6PS and a molecular weight of 395.37 g/mol. Its IUPAC name is 5-amino-5-(2-methylsulfanylethyl)-3-oxo-3-phenoxy-2,4,7-trioxa-3λ5-phosphabicyclo[6.2.2]dodeca-1(10),8,11-trien-6-one.
| Compound Name | 5-amino-5-(2-methylsulfanylethyl)-3-oxo-3-phenoxy-2,4,7-trioxa-3λ5-phosphabicyclo[6.2.2]dodeca-1(10),8,11-trien-6-one |
|---|---|
| PubChem CID | 142026651 |
| Molecular Formula | C17H18NO6PS |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | 5-amino-5-(2-methylsulfanylethyl)-3-oxo-3-phenoxy-2,4,7-trioxa-3λ5-phosphabicyclo[6.2.2]dodeca-1(10),8,11-trien-6-one |
| SMILES | CSCCC1(N)OP(=O)(Oc2ccccc2)Oc2ccc(cc2)OC1=O |
| InChI | InChI=1S/C17H18NO6PS/c1-26-12-11-17(18)16(19)21-13-7-9-15(10-8-13)23-25(20,24-17)22-14-5-3-2-4-6-14/h2-10H,11-12,18H2,1H3 |
| InChIKey | KEHXFMJZWWQRMC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|