C25H34FN3O3S — CID 142026662
3-(cyclohexylmethyl)-7-fluoro-8-methyl-3a,4,5,9b-tetrahydro-1H-benzo[e]indol-2-imine;N-methylfuran-2-sulfonamide (PubChem CID 142026662) has the molecular formula C25H34FN3O3S and a molecular weight of 475.63 g/mol. Its IUPAC name is 3-(cyclohexylmethyl)-7-fluoro-8-methyl-3a,4,5,9b-tetrahydro-1H-benzo[e]indol-2-imine;N-methylfuran-2-sulfonamide.
| Compound Name | 3-(cyclohexylmethyl)-7-fluoro-8-methyl-3a,4,5,9b-tetrahydro-1H-benzo[e]indol-2-imine;N-methylfuran-2-sulfonamide |
|---|---|
| PubChem CID | 142026662 |
| Molecular Formula | C25H34FN3O3S |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | 3-(cyclohexylmethyl)-7-fluoro-8-methyl-3a,4,5,9b-tetrahydro-1H-benzo[e]indol-2-imine;N-methylfuran-2-sulfonamide |
| SMILES | CNS(=O)(=O)c1ccco1.[H]/N=C1\CC2c3cc(C)c(F)cc3CCC2N1CC1CCCCC1 |
| InChI | InChI=1S/C20H27FN2.C5H7NO3S/c1-13-9-16-15(10-18(13)21)7-8-19-17(16)11-20(22)23(19)12-14-5-3-2-4-6-14;1-6-10(7,8)5-3-2-4-9-5/h9-10,14,17,19,22H,2-8,11-12H2,1H3;2-4,6H,1H3/b22-20+; |
| InChIKey | OMYUUXLUMYIZRL-QPNALZDCSA-N |
| XLogP | 4.98 |
| TPSA | 86.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|