C24H30FN3O2S2 — CID 142026700
N-[[4-[[(7-fluoro-1,3,3a,4,5,9b-hexahydrobenzo[e]indol-2-ylidene)amino]methyl]cyclohexyl]methyl]thiophene-3-sulfonamide (PubChem CID 142026700) has the molecular formula C24H30FN3O2S2 and a molecular weight of 475.66 g/mol. Its IUPAC name is N-[[4-[[(7-fluoro-1,3,3a,4,5,9b-hexahydrobenzo[e]indol-2-ylidene)amino]methyl]cyclohexyl]methyl]thiophene-3-sulfonamide.
| Compound Name | N-[[4-[[(7-fluoro-1,3,3a,4,5,9b-hexahydrobenzo[e]indol-2-ylidene)amino]methyl]cyclohexyl]methyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 142026700 |
| Molecular Formula | C24H30FN3O2S2 |
| Molecular Weight | 475.66 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | N-[[4-[[(7-fluoro-1,3,3a,4,5,9b-hexahydrobenzo[e]indol-2-ylidene)amino]methyl]cyclohexyl]methyl]thiophene-3-sulfonamide |
| SMILES | O=S(=O)(NCC1CCC(C/N=C2\CC3c4ccc(F)cc4CCC3N2)CC1)c1ccsc1 |
| InChI | InChI=1S/C24H30FN3O2S2/c25-19-6-7-21-18(11-19)5-8-23-22(21)12-24(28-23)26-13-16-1-3-17(4-2-16)14-27-32(29,30)20-9-10-31-15-20/h6-7,9-11,15-17,22-23,27H,1-5,8,12-14H2,(H,26,28) |
| InChIKey | RPVRLYFJBCVQPD-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.66 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|