C35H45N3O2S — CID 142026717
N-[[4-[(1,3,3a,4,5,9b-hexahydrobenzo[e]indol-2-ylideneamino)methyl]cyclohexyl]methyl]naphthalene-1-sulfonamide;(E)-pent-2-ene (PubChem CID 142026717) has the molecular formula C35H45N3O2S and a molecular weight of 571.83 g/mol. Its IUPAC name is N-[[4-[(1,3,3a,4,5,9b-hexahydrobenzo[e]indol-2-ylideneamino)methyl]cyclohexyl]methyl]naphthalene-1-sulfonamide;(E)-pent-2-ene.
| Compound Name | N-[[4-[(1,3,3a,4,5,9b-hexahydrobenzo[e]indol-2-ylideneamino)methyl]cyclohexyl]methyl]naphthalene-1-sulfonamide;(E)-pent-2-ene |
|---|---|
| PubChem CID | 142026717 |
| Molecular Formula | C35H45N3O2S |
| Molecular Weight | 571.83 g/mol |
| Exact Mass | 571.32 |
| IUPAC Name | N-[[4-[(1,3,3a,4,5,9b-hexahydrobenzo[e]indol-2-ylideneamino)methyl]cyclohexyl]methyl]naphthalene-1-sulfonamide;(E)-pent-2-ene |
| SMILES | C/C=C/CC.O=S(=O)(NCC1CCC(C/N=C2\CC3c4ccccc4CCC3N2)CC1)c1cccc2ccccc12 |
| InChI | InChI=1S/C30H35N3O2S.C5H10/c34-36(35,29-11-5-8-23-6-2-4-10-26(23)29)32-20-22-14-12-21(13-15-22)19-31-30-18-27-25-9-3-1-7-24(25)16-17-28(27)33-30;1-3-5-4-2/h1-11,21-22,27-28,32H,12-20H2,(H,31,33);3,5H,4H2,1-2H3/b;5-3+ |
| InChIKey | FFMNFZYJGHFCLK-GWDXERMASA-N |
| XLogP | 7.39 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.83 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|