About formaldehyde;6-[1-(methylamino)ethyl]naphthalen-1-ol
formaldehyde;6-[1-(methylamino)ethyl]naphthalen-1-ol (PubChem CID 142027103) has the molecular formula C14H17NO2
and a molecular weight of 231.29 g/mol. Its IUPAC name is formaldehyde;6-[1-(methylamino)ethyl]naphthalen-1-ol.
Molecular Properties
| Compound Name | formaldehyde;6-[1-(methylamino)ethyl]naphthalen-1-ol |
| PubChem CID | 142027103 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | formaldehyde;6-[1-(methylamino)ethyl]naphthalen-1-ol |
| SMILES | C=O.CNC(C)c1ccc2c(O)cccc2c1 |
| InChI | InChI=1S/C13H15NO.CH2O/c1-9(14-2)10-6-7-12-11(8-10)4-3-5-13(12)15;1-2/h3-9,14-15H,1-2H3;1H2 |
| InChIKey | XUTULVPDGDGOMO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze formaldehyde;6-[1-(methylamino)ethyl]naphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;6-[1-(methylamino)ethyl]naphthalen-1-ol?
The IUPAC name of formaldehyde;6-[1-(methylamino)ethyl]naphthalen-1-ol (CID 142027103) is formaldehyde;6-[1-(methylamino)ethyl]naphthalen-1-ol.
What is the SMILES notation for formaldehyde;6-[1-(methylamino)ethyl]naphthalen-1-ol?
The canonical SMILES for formaldehyde;6-[1-(methylamino)ethyl]naphthalen-1-ol is C=O.CNC(C)c1ccc2c(O)cccc2c1.
What is the InChIKey of formaldehyde;6-[1-(methylamino)ethyl]naphthalen-1-ol?
The InChIKey is XUTULVPDGDGOMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO.CH2O/c1-9(14-2)10-6-7-12-11(8-10)4-3-5-13(12)15;1-2/h3-9,14-15H,1-2H3;1H2.
What are the key properties of formaldehyde;6-[1-(methylamino)ethyl]naphthalen-1-ol?
formaldehyde;6-[1-(methylamino)ethyl]naphthalen-1-ol has a molecular weight of 231.29 g/mol, XLogP of 2.64, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;6-[1-(methylamino)ethyl]naphthalen-1-ol is sourced from PubChem (CID 142027103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).