About 3-methylpentane;pentanal
3-methylpentane;pentanal (PubChem CID 142027921) has the molecular formula C11H24O
and a molecular weight of 172.31 g/mol. Its IUPAC name is 3-methylpentane;pentanal.
Molecular Properties
| Compound Name | 3-methylpentane;pentanal |
| PubChem CID | 142027921 |
| Molecular Formula | C11H24O |
| Molecular Weight | 172.31 g/mol |
| Exact Mass | 172.18 |
| IUPAC Name | 3-methylpentane;pentanal |
| SMILES | CCC(C)CC.CCCCC=O |
| InChI | InChI=1S/C6H14.C5H10O/c1-4-6(3)5-2;1-2-3-4-5-6/h6H,4-5H2,1-3H3;5H,2-4H2,1H3 |
| InChIKey | XHSMMTBWSYEVMM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.31 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-methylpentane;pentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylpentane;pentanal?
The IUPAC name of 3-methylpentane;pentanal (CID 142027921) is 3-methylpentane;pentanal.
What is the SMILES notation for 3-methylpentane;pentanal?
The canonical SMILES for 3-methylpentane;pentanal is CCC(C)CC.CCCCC=O.
What is the InChIKey of 3-methylpentane;pentanal?
The InChIKey is XHSMMTBWSYEVMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14.C5H10O/c1-4-6(3)5-2;1-2-3-4-5-6/h6H,4-5H2,1-3H3;5H,2-4H2,1H3.
What are the key properties of 3-methylpentane;pentanal?
3-methylpentane;pentanal has a molecular weight of 172.31 g/mol, XLogP of 3.82, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylpentane;pentanal is sourced from PubChem (CID 142027921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).