About fluoro 3-(2,5-dioxopyrrol-1-yl)propanoate
fluoro 3-(2,5-dioxopyrrol-1-yl)propanoate (PubChem CID 142028939) has the molecular formula C7H6FNO4
and a molecular weight of 187.13 g/mol. Its IUPAC name is fluoro 3-(2,5-dioxopyrrol-1-yl)propanoate.
Molecular Properties
| Compound Name | fluoro 3-(2,5-dioxopyrrol-1-yl)propanoate |
| PubChem CID | 142028939 |
| Molecular Formula | C7H6FNO4 |
| Molecular Weight | 187.13 g/mol |
| Exact Mass | 187.03 |
| IUPAC Name | fluoro 3-(2,5-dioxopyrrol-1-yl)propanoate |
| SMILES | O=C(CCN1C(=O)C=CC1=O)OF |
| InChI | InChI=1S/C7H6FNO4/c8-13-7(12)3-4-9-5(10)1-2-6(9)11/h1-2H,3-4H2 |
| InChIKey | XJEWCIWKWMXONG-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.13 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze fluoro 3-(2,5-dioxopyrrol-1-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro 3-(2,5-dioxopyrrol-1-yl)propanoate?
The IUPAC name of fluoro 3-(2,5-dioxopyrrol-1-yl)propanoate (CID 142028939) is fluoro 3-(2,5-dioxopyrrol-1-yl)propanoate.
What is the SMILES notation for fluoro 3-(2,5-dioxopyrrol-1-yl)propanoate?
The canonical SMILES for fluoro 3-(2,5-dioxopyrrol-1-yl)propanoate is O=C(CCN1C(=O)C=CC1=O)OF.
What is the InChIKey of fluoro 3-(2,5-dioxopyrrol-1-yl)propanoate?
The InChIKey is XJEWCIWKWMXONG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6FNO4/c8-13-7(12)3-4-9-5(10)1-2-6(9)11/h1-2H,3-4H2.
What are the key properties of fluoro 3-(2,5-dioxopyrrol-1-yl)propanoate?
fluoro 3-(2,5-dioxopyrrol-1-yl)propanoate has a molecular weight of 187.13 g/mol, XLogP of -0.27, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro 3-(2,5-dioxopyrrol-1-yl)propanoate is sourced from PubChem (CID 142028939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).