C10H12BrF5N2 — CID 142029583
4-bromo-3-tert-butyl-1-methyl-5-(1,1,2,2,2-pentafluoroethyl)pyrazole (PubChem CID 142029583) has the molecular formula C10H12BrF5N2 and a molecular weight of 335.11 g/mol. Its IUPAC name is 4-bromo-3-tert-butyl-1-methyl-5-(1,1,2,2,2-pentafluoroethyl)pyrazole.
| Compound Name | 4-bromo-3-tert-butyl-1-methyl-5-(1,1,2,2,2-pentafluoroethyl)pyrazole |
|---|---|
| PubChem CID | 142029583 |
| Molecular Formula | C10H12BrF5N2 |
| Molecular Weight | 335.11 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 4-bromo-3-tert-butyl-1-methyl-5-(1,1,2,2,2-pentafluoroethyl)pyrazole |
| SMILES | Cn1nc(C(C)(C)C)c(Br)c1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H12BrF5N2/c1-8(2,3)6-5(11)7(18(4)17-6)9(12,13)10(14,15)16/h1-4H3 |
| InChIKey | SBKFJTHKRWYUMF-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.11 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|